On Target CXCR1_HUMAN 0.31443298/CHEMBL3426944
For the given ligand suplatast, we have found in our database that, being scored 0.31443298, the most similar ligand is CHEMBL3426944. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3426944 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | OB(O)c1ccc(OC(F)(F)F)cc1CSc2ccc(cn2)C(=O)Nc3ccc(F)cc3 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 10004202 4180da08 201265aa 0231a611 01051010 00000010 02024100 02001004 00020000 00004841 01688004 6040c004 00009802 40151000 01201041 0004000c 14040008 03000105 08280020 00220200 e0100000 084c8e00 20812008 0068000d 00040000 d0008000 48018000 c0000081 02408314 00868005 90000000 80010260 |