On Target CLTR1_HUMAN 0.38690478/CHEMBL3342949
For the given ligand suplatast, we have found in our database that, being scored 0.38690478, the most similar ligand is CHEMBL3342949. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3342949 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | OC(=O)C1CNc2cc(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)ccc2O1 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04006002 01000808 2010110b 00010702 a8081080 02000000 02040800 02001008 00020820 00080840 083c0004 5001d000 08808822 00300000 11221041 00086008 00840000 82000000 08c00010 00020001 41100100 18068e00 37412080 08408014 00080000 80100000 28260408 80800080 00808300 00060003 80040400 00000600 |