On Target GRM5_HUMAN 0.36708862/CHEMBL206427
For the given ligand suplatast, we have found in our database that, being scored 0.36708862, the most similar ligand is CHEMBL206427. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL206427 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CN(C(=O)Cc1c(F)cccc1F)c2cc(C)cc(OCc3cccc(Cl)c3)c2 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 0400c002 d0800008 60100108 02010600 34001400 04004010 06000000 00040000 00000100 00090850 08280004 c0009800 03808006 08111080 c1020041 02080008 01040280 02000000 08080000 00022600 40100000 18200720 20002000 81c01011 00042000 80002000 00000000 00000081 04c08200 00068003 40002000 00020600 |