On Target MSHR_HUMAN 0.33/CHEMBL591037
For the given ligand suplatast, we have found in our database that, being scored 0.33, the most similar ligand is CHEMBL591037. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL591037 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CC(C)N(C(=O)CN1C=CN(C(=O)C(Cc2n[nH]c3ccccc23)C1=O)c4ccccc4)c5ccc(OC(F)(F)F)cc5 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00404002 00002608 2010012a 04012600 29041010 00002002 02000220 20000608 00000920 000c0be0 08388004 7040b040 0e008022 00702000 81020041 0004204c 00240001 26008000 08600218 60220261 60508100 3d000608 24802809 0260001a 00103800 a0000000 00160000 d0080180 0a008206 2406801b 22004020 00004620 |