On Target CNR1_HUMAN 0.43373495/CHEMBL410337
For the given ligand suplatast, we have found in our database that, being scored 0.43373495, the most similar ligand is CHEMBL410337. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL410337 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1ccc(cc1)C2C(CCS(=O)(=O)c3ccccc3)C(=O)N2c4ccccc4 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00004002 05801208 2032010a 00910600 20001000 02002180 02040000 22001000 84000800 000848c0 08782004 7006d000 0c018802 00340000 87220441 00040008 04040000 02000000 08004018 00022201 c0100100 18048601 20812100 08640019 00002800 c0000000 00320300 90000080 00008300 0006000b 30040000 01010620 |