On Target ADA2B_HUMAN 0.34751773/CHEMBL518592
For the given ligand suplatast, we have found in our database that, being scored 0.34751773, the most similar ligand is CHEMBL518592. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL518592 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1ccccc1N2CCN(CC3COc4ccccc4O3)CC2 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04006002 00000008 20100128 04210602 80001080 02000000 02000200 00000000 00002000 00000a40 00200004 40008000 00804002 00002000 01301041 0208e008 10240000 00000000 08800002 00020200 40100000 38040000 370000a1 0a008012 00000001 00000000 20000000 00800081 08008200 00060008 00000800 000002c0 |