On Target NPY4R_HUMAN 0.29661018/CHEMBL3559801
For the given ligand suplatast, we have found in our database that, being scored 0.29661018, the most similar ligand is CHEMBL3559801. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3559801 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CC(C)(C)c1ccc(OC2CCCCC2O)cc1 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04000000 01000008 20000108 00010300 00081000 02000000 02040000 00000000 00000000 00080840 08000000 40008000 00800002 00800000 11200001 00082008 00800000 02000000 02402000 00020001 00000000 08000000 05000000 08400010 00000000 80000000 00120000 00800000 00000200 00020002 00000000 00000400 |