On Target NK1R_HUMAN 0.38297874/CHEMBL162332
For the given ligand suplatast, we have found in our database that, being scored 0.38297874, the most similar ligand is CHEMBL162332. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL162332 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1ccccc1CN(CC(NC(=O)CN2CCN(CC2)c3ccccc3)c4ccccc4)C(=O)C |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00004002 00803008 20100128 04010600 00001000 00000100 02000000 0200140c 00000080 00190a40 08200004 4000a000 02008802 00002001 01000641 00002008 00040000 02000000 08000000 00020200 c0100000 38208600 20000022 8340001a 00000000 c0000000 00000000 80000080 0c008300 00060003 24044000 00000600 |