On Target HRH3_HUMAN 0.48366013/CHEMBL240187
For the given ligand suplatast, we have found in our database that, being scored 0.48366013, the most similar ligand is CHEMBL240187. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL240187 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CS(=O)(=O)c1ccc(cc1)C(=O)N2CCN(C(=O)C2)c3ccc(OCCCN4CCCCC4)cc3 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 0400c002 01803a08 20120128 04910600 00001000 02000000 02000000 22001008 00000000 00010ac0 00282004 7001a000 02808822 00112001 81200441 00082008 04240000 02000001 08800000 00022201 c0100000 380a8600 218020a0 0a50001f 00000001 c0000000 00040000 900000a0 08008300 00060001 a0044000 00012260 |