On Target 5HT5A_HUMAN 0.3090909/CHEMBL3326993
For the given ligand suplatast, we have found in our database that, being scored 0.3090909, the most similar ligand is CHEMBL3326993. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3326993 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1ccccc1N2CCN(CCCCCC(=O)NCc3ccccc3c4ccccc4Cl)CC2 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 0001e002 01800009 20100128 14010600 80001000 10080000 02000000 26001000 00000000 10000ac0 00200004 40019800 0600880e 00202000 210004c1 00004008 00060000 06000000 0c002000 00420201 c0120000 38008710 30000021 0250801a 00002000 c0000200 20004000 900000c0 0800c300 00060001 20040800 00020200 |