On Target TAAR1_HUMAN 0.4790419/CHEMBL1490462
For the given ligand suplatast, we have found in our database that, being scored 0.4790419, the most similar ligand is CHEMBL1490462. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL1490462 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | Cc1cc2NC(=O)COc2cc1S(=O)(=O)CCC(=O)NCCc3ccccc3 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04006002 04803208 60121108 00910642 84001480 00040020 02040000 0004000c 00020080 00084850 086c2004 6000d000 00818002 10140000 83201241 00084408 04040080 82000000 08004000 00422200 c1100010 18240602 32802200 8944c019 08042201 80040000 28028048 008000c0 04408200 00060023 10000000 01012620 |