On Target ACM4_HUMAN 0.35416666/CHEMBL71531
For the given ligand suplatast, we have found in our database that, being scored 0.35416666, the most similar ligand is CHEMBL71531. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL71531 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1ccc(cc1)S(=O)(=O)c2ccc(cc2)C(=O)C3CCN(CC3)C4CCCCC4 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00020000 01805a08 2012010a 00910600 00041000 00000000 02000000 20000000 00100800 000808c0 08302000 70019000 04008002 00210000 81200001 00000008 04001000 02000001 02202400 00022201 80000100 18060210 00800000 0850001d 00000000 80000000 00800000 100000a0 00000200 00060002 80000000 00812620 |