On Target V1AR_HUMAN 0.40127388/CHEMBL3416769
For the given ligand suplatast, we have found in our database that, being scored 0.40127388, the most similar ligand is CHEMBL3416769. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3416769 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | Cc1ccccc1C(=O)Nc2ccc(cc2)C(=O)N3CCC[S+]([O-])c4ccccc34 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00004002 00801a80 00120100 b8510640 20000000 00008000 00004000 02001200 00020000 00084840 00684004 6000c040 01018802 00348000 02020640 00000002 04041000 02010000 08000000 00000200 c0320000 18028600 20812210 0048001d 0000e000 c0800110 00000000 c8010080 00008100 00064021 b204a020 01010220 |