On Target NPFF1_HUMAN 0.27586207/CHEMBL575058
For the given ligand YJING, we have found in our database that, being scored 0.27586207, the most similar ligand is CHEMBL575058. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL575058 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | NC(=N)N\N=C(/c1ccccc1)\c2ccc(Cl)c(Cl)c2 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00008008 04000000 00000100 00010a00 00002000 00000000 04000000 81084000 00000100 000c0847 08000000 40008800 82000024 00000000 80000000 00080000 04000000 02000000 00000400 00000000 00080000 08000100 40040000 00400010 00002000 a0100800 40040100 40000000 000000a8 000e0402 40100800 00020400 |