On Target 5HT1F_HUMAN 0.23333333/CHEMBL39
For the given ligand YJING, we have found in our database that, being scored 0.23333333, the most similar ligand is CHEMBL39. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL39 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | NCCc1c[nH]c2ccc(O)cc12 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00000002 00000808 20000100 41010610 00041000 00000000 06002000 00000000 00400000 00090840 08000004 40008000 10000806 00400000 00000040 0004000c 00000000 02000000 00200400 00020000 40000000 18008008 20800000 81400010 00042000 80000000 08120000 00000000 04000000 00060002 00040200 00000420 |