On Target BKRB2_HUMAN 0.3523316/CHEMBL559565
For the given ligand YJING, we have found in our database that, being scored 0.3523316, the most similar ligand is CHEMBL559565. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL559565 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | Cc1cc(c2ccnn2C)c3cccc(OCc4c(C)ccnc4CNC(=O)C5CCCCC5)c3n1 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04016006 01800808 e2104108 10010e10 010c1020 04104006 12c40000 2a223001 10000100 000008c0 00218004 60059800 84c0883a 08618000 010204c1 020c210c 00020000 02001006 0e612000 00220a01 c0120000 18038658 30880800 82d0d01c 00140400 c0082400 18024240 90000061 00404305 00060001 e0060600 00004220 |