On Target OPRX_HUMAN 0.5555556/CHEMBL3928651
For the given ligand YJING, we have found in our database that, being scored 0.5555556, the most similar ligand is CHEMBL3928651. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3928651 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1ccc(CN(C)C2(CCC(CC2)(N(C)C)c3ccccc3)c4ccccc4)cc1 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00000000 01000008 2010010a 00010600 00001000 00000000 02040000 22001000 00300800 000808c0 08300000 40038000 00000802 00200000 01000401 00000008 00002000 02000000 02002000 00020201 00000100 18008010 00000000 00500010 00000000 c0000000 00220000 90000000 00000302 00060002 20060000 00000600 |