On Target PTAFR_HUMAN 0.40425533/CHEMBL53585
For the given ligand YJING, we have found in our database that, being scored 0.40425533, the most similar ligand is CHEMBL53585. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL53585 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1ccc(cc1OC)c2ccc(cc2)C(=O)N[C@H](C)CCCc3cccnc3 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00002002 41005808 2010410a 40810610 00041100 00000000 02042000 22001000 00500900 000808c0 00300004 40018000 8000c812 00200800 01000401 0004800c 00020040 02000004 04282400 10021201 40000100 18068600 30800000 0050001c 00040000 c0000000 08020000 90000040 00404302 0006000b a0041000 00000600 |