On Target DRD3_HUMAN 0.12765957/CHEMBL1123
For the given ligand chongqian, we have found in our database that, being scored 0.12765957, the most similar ligand is CHEMBL1123. Check out the elaboration below.
| chongqian (Given Ligand) | CHEMBL1123 (Similar Ligand) |
|---|---|
| CC2CCCC(C1CCCCCC1)CC2 | CCN(CC)CCOC(=O)C1(CCCCC1)C2CCCCC2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00001000 00000000 00000000 00020000 00000000 | 00010000 01000000 00000200 80010700 00080080 00000000 00000000 00000000 00000000 00000000 00200000 40009000 0400800a 00800000 00001008 00081008 10860000 00000000 02402000 00000001 00000020 00000a00 13000000 00000010 10000400 00000000 00000000 00000001 00000200 00040000 00020000 00000200 |