On Target 5HT7R_HUMAN 0.094736844/CHEMBL2158034
For the given ligand Asprin, we have found in our database that, being scored 0.094736844, the most similar ligand is CHEMBL2158034. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL2158034 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | CCOc1ccccc1C(=O)NC2CCN(CCOc3ccccc3C(C)C)CC2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 04002000 01001c08 20100108 00010602 00001080 80020100 02000000 22001600 00000000 001809e0 08200000 50018020 00808802 00000000 01081401 00082008 10000000 02028000 00000000 00020201 00000040 180e8600 12000000 0050001c 00000000 c0000000 00000800 90000001 00000300 00060013 a4040000 00000600 |