On Target 5HT1F_HUMAN 0.06422018/CHEMBL187928
For the given ligand Asprin, we have found in our database that, being scored 0.06422018, the most similar ligand is CHEMBL187928. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL187928 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | OC(=O)C(F)(F)F.O=C(\C=C\c1ccccc1)N(Cc2ccc(cc2)c3ccc(CNCCc4ccccc4)cc3)Cc5cccnc5 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 10002002 01808000 00104100 00010610 00041000 00000000 80104080 02001400 01800180 00480840 09200004 40008000 80008802 00010000 00000402 000c000c 20022400 02000104 04218000 10800204 c0000000 18208e00 30800000 81400018 00040000 c0000000 08482200 d0010040 04404100 00060003 24040000 80000600 |