On Target ADRB3_HUMAN 0.0703125/CHEMBL4065251
For the given ligand Asprin, we have found in our database that, being scored 0.0703125, the most similar ligand is CHEMBL4065251. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL4065251 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | CCn1nnc(CN2CCN(CC2)C(=O)c3ccc(C[C@@H]4CC[C@@H](N4)[C@H](O)c5ccccc5)cc3)n1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00000004 11002818 40500102 44010e00 20080080 0000c018 00000000 02483408 00000980 001908c0 08310008 40218800 80008882 01a02000 00080400 0008200c 10000000 03000800 00402000 00040201 00060100 38228630 03001024 8340001c 00200800 c0000000 00000000 80000000 0d000106 00060003 d4060000 0800a602 |