On Target V1AR_HUMAN 0.08421053/CHEMBL1083254
For the given ligand Asprin, we have found in our database that, being scored 0.08421053, the most similar ligand is CHEMBL1083254. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL1083254 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | COc1cc(ccc1\C=C\c2ccccc2)C(=O)N3C[C@]4(C)C[C@H]3CC(C)(C)C4 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00000000 45001808 20100108 40010600 00201000 00040010 82000080 22001400 00000104 000008c0 00200100 40018000 80008802 00000000 01004403 20002008 00000400 02000000 12082000 80020201 01000000 18068610 00000000 0054801c 00000000 c0000000 00402000 d0000000 00400300 00060001 a4060000 00002200 |