On Target 5HT1A_HUMAN 0.40127388/CHEMBL252258
For the given ligand test1, we have found in our database that, being scored 0.40127388, the most similar ligand is CHEMBL252258. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL252258 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC(=O)N1C2CCCC1C=C(CN3C4CCC3CC(C4)NC(=O)Nc5cc(F)cc(c5)C(F)(F)F)C2 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00000036 09009400 02100100 02010e00 04000100 00000010 00180404 20002403 08200000 001069f8 00280004 71038004 00039102 09111000 00000440 00000100 20040000 02400140 48002002 00000211 40000100 180d0610 2002a000 00500018 00350000 80000004 00484000 90001181 00408000 00068411 2c1a0000 02006200 |