On Target GRM4_HUMAN 0.259887/CHEMBL1921962
For the given ligand test1, we have found in our database that, being scored 0.259887, the most similar ligand is CHEMBL1921962. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1921962 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | Clc1cc(NC(=O)c2ccccn2)ccc1N3C(=O)[C@@H]4[C@@H]5CC[C@@H](C=C5)[C@@H]4C3=O |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 0003c002 01201800 00104100 11000e00 20060020 00102010 08000000 2a001403 10000000 001088c0 00290004 4001d800 0602880e 00100001 00020440 02040104 00044000 0a000020 0a212000 02004201 40120000 18068710 2081a000 0051001c 00302000 80000401 00404040 90000080 04008106 80060001 a4060000 00826200 |