On Target AA3R_HUMAN 0.39814815/CHEMBL275040
For the given ligand test1, we have found in our database that, being scored 0.39814815, the most similar ligand is CHEMBL275040. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL275040 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC(=C)[C@H]1CN[C@@H]([C@H]1CC(=O)O)C(=O)O |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00030000 09000000 00100000 00000400 00180080 00000010 00080000 20000400 10000000 00128088 00200000 40013000 0600803a 03800000 80080400 00080008 10004000 00000000 00402000 00000201 00000000 10000a00 03000000 00100010 00000000 00000000 00000000 90000000 00000000 00040000 04004000 00802a00 |