On Target CXCR1_HUMAN 0.24038461/CHEMBL556862
For the given ligand test1, we have found in our database that, being scored 0.24038461, the most similar ligand is CHEMBL556862. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL556862 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC[C@@H](NC1=C(Nc2cccc(C(=O)N3CCCC3C(=O)O)c2O)C(=O)C1=O)c4ccccc4 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 1041c00a 01005808 60100102 00012600 20090081 68022010 020000a0 22401500 05a00c40 001808d0 08380004 5043b000 0e008812 01200000 800a0440 10086048 10050001 22008000 08630210 20020201 48100980 18168e00 23000000 0050801c 04041000 c0000080 20400010 900c0580 20508102 20060003 a4045420 40002600 |