On Target CLTR1_HUMAN 0.3181818/CHEMBL288943
For the given ligand test1, we have found in our database that, being scored 0.3181818, the most similar ligand is CHEMBL288943. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL288943 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CCCCC\C=C/C\C=C/C=C/C=C/[C@@H](SC[C@H](N)C(=O)NCC(=O)O)[C@@H](O)CCCC(=O)O |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00010402 43044000 20120000 00100440 41080080 00000001 00000000 00000402 04208000 00144040 00201200 40063000 0603802a 02840001 80190404 0008000c 14800000 00000000 00402080 00620201 40002001 30000e00 03008300 0220081a 00218200 00000010 00404000 80000010 08000000 40140121 24824000 07010200 |