On Target NPY4R_HUMAN 0.3121019/CHEMBL2440119
For the given ligand test1, we have found in our database that, being scored 0.3121019, the most similar ligand is CHEMBL2440119. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL2440119 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | C[C@@H](O)[C@H](NC(=O)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H]1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00010000 01007608 20100100 04010e00 00000080 00000000 02000000 2000200c 00200a80 000809e2 08300000 4003b000 1e00901a 00002001 80000000 00180008 10000000 02000001 00802018 00020201 00000100 382d0630 03000083 83500018 00001801 80000000 40120000 10000000 0c000010 0106001b a0084000 00002600 |