On Target NPSR1_HUMAN 0.2822086/CHEMBL1210412
For the given ligand test1, we have found in our database that, being scored 0.2822086, the most similar ligand is CHEMBL1210412. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1210412 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CN1C(=O)C(=Cc2ccccc12)CN(C(=O)C3CCCCC3)C4(CCN5CCOCC5)CCCCC4 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 10010002 0180d400 00104100 80010610 00041082 00004060 00004000 22001000 06000001 400009e0 05200004 40019000 0400980a 00600000 00181448 000c010c 10020000 82000004 02202000 00000201 c0000000 180c8e18 32800000 80700018 00040400 c0000000 08800000 90000001 00400300 00060051 20060000 80002200 |