On Target AA2BR_HUMAN 0.24742268/CHEMBL440115
For the given ligand test1, we have found in our database that, being scored 0.24742268, the most similar ligand is CHEMBL440115. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL440115 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | OCC[C@H]1CCCCN1C(=O)\C=C\c2c(nn3ccccc23)c4ccccc4 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 10082002 41009809 a0104180 02010610 010c1004 00000002 82500080 20000400 03800000 204028c0 00200084 70118000 80008812 08e10000 20000802 004c200c 20220400 02000100 04e1a000 00a20203 40100008 1c168618 318008c0 80704018 00140001 80000001 184a2000 50010060 00404004 00060101 04060200 02806220 |