On Target V1AR_HUMAN 0.3316062/CHEMBL397189
For the given ligand test1, we have found in our database that, being scored 0.3316062, the most similar ligand is CHEMBL397189. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL397189 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC(C)C[C@H](N1[C@H](\C=C\c2ccccc2)[C@H](N3[C@H](COC3=O)c4ccccc4)C1=O)C(=O)N5CCC(CC5)N6CCCCC6 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00018000 09c0fc00 00100300 84010600 000000c0 00018000 80180080 22001448 10800200 005909e8 08200800 5001b000 0e028802 00012103 801c1403 001a0008 38064400 02080140 44040810 02801201 80000000 380c8e10 13008023 0250001c 01001000 c0041002 10482000 d0210121 0c400300 80060c13 ac044000 02002600 |