On Target 5HT7R_HUMAN 0.26630434/CHEMBL487192
For the given ligand yong1, we have found in our database that, being scored 0.26630434, the most similar ligand is CHEMBL487192. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL487192 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | OC(=O)[C@@H](OC(=O)\C=C\c1ccc(O)c(O)c1)[C@](O)(Cc2ccc(O)c(O)c2)C(=O)O |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00050000 43000008 20000502 00010300 002c0041 40200000 82000080 00000400 01800800 01080840 48100000 4010d080 1c008002 00200000 00040002 00089008 08020400 82000000 21418018 00020201 00000120 08000a00 05000041 08400014 00001c00 80000000 0052a000 40000420 00400202 0002010a 04000000 02400410 |