On Target 5HT1E_HUMAN 0.15833333/CHEMBL343755
For the given ligand yong1, we have found in our database that, being scored 0.15833333, the most similar ligand is CHEMBL343755. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL343755 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | C[C@H]1C[C@H](C)N1C(=O)[C@H]2CN(C)C3Cc4c[nH]c5cccc(C3=C2)c45 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00000012 2910dc00 01900302 41910610 00041100 00000000 800820c0 20000402 004008c0 001909ea 08300004 41009000 98028902 00610800 00000043 000e020c 20000400 02000144 00220412 00000201 40000500 1a248608 20808000 91400018 01243000 80000000 08482048 d0000000 04404000 00260c13 24040200 02012620 |