On Target HRH3_HUMAN 0.2513089/CHEMBL471555
For the given ligand yong1, we have found in our database that, being scored 0.2513089, the most similar ligand is CHEMBL471555. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL471555 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | C[C@@H]1CCCN1CCc2ccc(cc2)C3=CC[C@H]4CN(C[C@@H]34)C(=O)C5CCOCC5 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00040000 09001200 00100302 00010700 80180000 00000010 80080080 20000402 10100980 001808c8 08300000 41019800 04028002 00200000 00000402 000c1008 00004400 02000140 40412000 00000201 01000120 18240600 01008020 81500018 01200400 80200000 00406200 d0000000 04400202 0006040b 04000000 00002e00 |