On Target ADRB3_HUMAN 0.21428572/CHEMBL1086536
For the given ligand yong1, we have found in our database that, being scored 0.21428572, the most similar ligand is CHEMBL1086536. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1086536 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CC(=O)O.OCc1cc(ccc1O)[C@@H](O)CNCCCCCCOCCOCc2cccc(O)c2 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00000000 49000008 a0100100 00010700 00081091 00004000 02000000 20000840 00002180 000808c8 a8200000 40018000 00008002 00810000 00080000 0208b008 10800000 02000000 00402000 40020201 00000020 18200a30 07000000 89500010 00000400 80002000 005a0000 10000020 04000200 00060002 40000000 00002600 |