On Target 5HT7R_HUMAN 0.46875/CHEMBL487192
For the given ligand vs-17, we have found in our database that, being scored 0.46875, the most similar ligand is CHEMBL487192. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL487192 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | OC(=O)[C@@H](OC(=O)\C=C\c1ccc(O)c(O)c1)[C@](O)(Cc2ccc(O)c(O)c2)C(=O)O |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00050000 43000008 20000502 00010300 002c0041 40200000 82000080 00000400 01800800 01080840 48100000 4010d080 1c008002 00200000 00040002 00089008 08020400 82000000 21418018 00020201 00000120 08000a00 05000041 08400014 00001c00 80000000 0052a000 40000420 00400202 0002010a 04000000 02400410 |