On Target TSHR_HUMAN 0.22941177/CHEMBL3913851
For the given ligand vs-17, we have found in our database that, being scored 0.22941177, the most similar ligand is CHEMBL3913851. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL3913851 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CC(=O)N1c2ccc(NC(=O)OCCOc3ccccc3)cc2C(C)(CC1(C)C)c4ccccc4 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 0c004002 01401209 2010050a 00010600 24005020 00082040 03000000 21000000 00402a04 000808d0 08380024 40008010 00808002 00300800 01220041 001c0008 00068000 02800001 0800080a 00420201 44100100 18040e10 24002002 08400018 00040000 a1000002 00000010 508010c0 00488280 8006000b 00000080 20000600 |