On Target HRH3_HUMAN 0.5412844/CHEMBL1822856
For the given ligand vs-17, we have found in our database that, being scored 0.5412844, the most similar ligand is CHEMBL1822856. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1822856 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | C(COc1ccc(cc1)C2CCCCO2)CN3CCCCC3 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04000000 01000008 2010010a 00010700 80081010 02004000 02040000 20000000 00000900 000808c0 08300000 50018000 00800002 00a10000 01000001 02083008 00200000 02000000 00c02000 00020201 00000120 18000020 01000080 00500010 00000401 80002000 005a0000 10000000 00000202 00060002 40000000 02002640 |