On Target 5HT5A_HUMAN 0.37288135/CHEMBL278751
For the given ligand vs-17, we have found in our database that, being scored 0.37288135, the most similar ligand is CHEMBL278751. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL278751 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CCCN(CCC)[C@@H]1CCc2c(OC)cccc2[C@@H]1C |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00000000 43000208 2010010a 00010600 00001020 c0000002 02000000 20000201 00000880 000808c0 08300000 40808040 00000002 20200000 01000001 02042008 00000200 02000000 00082000 00020201 00000100 18200000 00004000 81400410 00000000 c0000001 00000000 10000000 04000302 0006c00a 00000000 00002600 |