On Target 5HT1D_HUMAN 0.43939394/CHEMBL100086
For the given ligand vs-17, we have found in our database that, being scored 0.43939394, the most similar ligand is CHEMBL100086. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL100086 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1cccc(CN2CCN(CC2)C3CCC(O)(CC3)c4ccc5OCOc5c4)c1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00000000 4f000008 2010010a 04010600 00181000 40004000 02040000 22001000 00300900 000908c0 48300000 40018000 00004802 20a02000 01000405 00288008 00000000 02000000 02482000 00020201 00040300 38008030 01000021 02548010 40000000 c0000000 00520000 b0000000 09000302 00060002 40060000 00010e00 |