On Target NK1R_HUMAN 0.3649635/CHEMBL282618
For the given ligand Ginkgo B, we have found in our database that, being scored 0.3649635, the most similar ligand is CHEMBL282618. Check out the elaboration below.
| Ginkgo B (Given Ligand) | CHEMBL282618 (Similar Ligand) |
|---|---|
| [H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O | NCCCCCOC[C@H]1O[C@@H](OCCc2c[nH]c3ccccc23)[C@H](OCc4ccccc4)[C@@H](OCc5ccccc5)[C@@H]1OCc6ccccc6 |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 0000004a 01000800 80000100 40810710 802c1050 00004000 00002800 08000040 00602100 010828e0 08000004 40018000 00000800 03c10000 000c0040 022e900c 18800020 02000000 1560a400 00000001 40110020 18008028 25800000 88400010 00042400 80002000 08080000 24000020 00000200 00060002 40a40200 02000420 |