On Target GASR_HUMAN 0.2159091/CHEMBL433028

For the given ligand Ginkgo B, we have found in our database that, being scored 0.2159091, the most similar ligand is CHEMBL433028. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL433028 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CCOC(=O)CCCOc1ccc(NC(=O)NC2C(=O)N(CC34C[C@@H]5C[C@@H](C[C@@H](C5)C3)C4)c6ccccc6N(C2=O)c7ccccc7)cc1
2d depiction of Ginkgo B 2d depiction of CHEMBL433028
3d depiction of Ginkgo B 3d depiction of CHEMBL433028
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 04054006 01003408 20100029 04010f00 20201000 02002000 02000014 20302009 00002100 00020be0 00282004 5001b000 0c80a022 00102000 11060041 00083008 00060010 10404100 1a402012 10020201 60100120 38050e10 21022001 0210001a 00101400 00000000 02040020 10008080 08008200 02060011 20025000 00006200