On Target BKRB2_HUMAN 0.18811882/CHEMBL2372276
For the given ligand test1, we have found in our database that, being scored 0.18811882, the most similar ligand is CHEMBL2372276. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL2372276 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | N[C@@H](CCCN=C(N)N)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CCC[C@H]2C(=O)N3CCC[C@H]3C(=O)NCC(=O)N[C@@H](Cc4ccccc4)C(=O)N[C@@H](CO)C(=O)[C@@H]5CCCN5C(=O)N[C@@H](Cc6ccccc6)C(=O)N[C@H](CCCN=C(N)N)C(=O)O |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00010000 01007600 00100100 04010e00 00180082 00000010 00010004 2000200c 00200880 000a09e2 08300010 4003b000 1600b012 01802009 80180000 000c0008 10000818 02000000 00402048 00000201 00000100 382d0e30 03000003 83500018 00010800 80000000 40010000 10000000 0c000000 0006001b 201a4000 00002e00 |