On Target CNR1_HUMAN 0.32666665/CHEMBL1923760
For the given ligand test1, we have found in our database that, being scored 0.32666665, the most similar ligand is CHEMBL1923760. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1923760 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CCCCCCc1ccc(O)cc1OCCCCCCCC(=O)OC(CO)CO |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 04010001 01000008 2000050a 00010300 00081000 82000000 42000000 00000200 00000800 00080840 08100000 40009040 0480800a 00a00000 11000001 0008b008 00820000 22008000 01402000 00020801 00000120 08000a00 05000000 08400410 00000400 c0000000 00120000 00000020 00010302 00024002 00020000 00000400 |