On Target ADRB3_HUMAN 0.32051283/CHEMBL1085395
For the given ligand test1, we have found in our database that, being scored 0.32051283, the most similar ligand is CHEMBL1085395. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1085395 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CC(=O)O.OCc1cc(ccc1O)[C@@H](O)CNCCCCCCOCCOCc2ccccc2 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00000000 01000008 a0100100 00010700 00081091 00004000 02000000 20000840 00002180 000808c0 a8200000 40018000 00008002 00810000 00080000 0208b008 10800000 02000000 00402000 40020201 00000020 18200a30 07000000 89500010 00000400 80002000 005a0000 10000020 04000200 00060002 40000000 00002600 |