On Target EDNRA_HUMAN 0.35714287/CHEMBL103190
For the given ligand test1, we have found in our database that, being scored 0.35714287, the most similar ligand is CHEMBL103190. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL103190 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | Cc1ccc(CCCOC(C(Oc2nc(C)cc(C)n2)C(=O)O)(c3ccccc3)c4ccccc4)cc1 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00000042 00000818 00000100 00050700 80040050 00204100 00000000 01000040 00012b00 01080840 081c0004 4000d800 14008080 00110100 20460200 021c900c 18000000 82000000 05400008 00000001 00020160 08000a20 25c00040 08400114 00000c00 a1002000 00080000 40000020 01000284 00420002 d0000000 060004a0 |