On Target CCR2_HUMAN 0.37974682/CHEMBL3754764
For the given ligand Ibuprofen, we have found in our database that, being scored 0.37974682, the most similar ligand is CHEMBL3754764. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL3754764 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | C[C@H]1CC=C(C(=O)O)[C@@](C)(C1)c2ccc(C)c3ccccc23 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00010000 01000000 00000102 00010200 00080000 00800000 00000081 08000402 01000900 00980840 08100000 40009800 04028008 00a00000 00000400 00080008 00000000 02100020 00612018 00000801 00000100 08000a88 01008040 00400010 00201800 80000400 00404000 80000000 00000002 00020002 24020000 00000400 |