On Target CCKAR_HUMAN 0.23841059/CHEMBL249560
For the given ligand Ibuprofen, we have found in our database that, being scored 0.23841059, the most similar ligand is CHEMBL249560. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL249560 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | COc1ccc(cc1)n2nc(CC(C(=O)O)c3ccc(C)cc3)cc2c4ccc(C)cc4 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 02006006 00000208 a0000108 00018600 01085040 00004002 02440000 00001208 00000904 000d08c0 09108004 60029848 0d008812 00000200 41840041 000c200c 48020000 06801000 04400018 10220041 40100100 1851aa20 358008c0 83404418 00002800 c00000c0 10160000 00000861 04004304 0046000a 40062200 830005a2 |