On Target ACM1_HUMAN 0.5151515/CHEMBL2164888
For the given ligand Ibuprofen, we have found in our database that, being scored 0.5151515, the most similar ligand is CHEMBL2164888. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL2164888 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CN(C)CCOC(=O)C(Cc1ccccc1)c2ccccc2 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 00000008 00000300 80010700 000000c0 00000000 00000000 00000040 00000800 00080840 08300000 40009000 05008000 00000000 40041008 00081008 08060000 02000000 04400008 00000001 00010120 08100a00 13000040 00400010 10000c00 80000000 00000000 00000000 00000200 00060002 00002000 00000700 |